C19H22NO3+ — CID 8876973
1-(2,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone (PubChem CID 8876973) has the molecular formula C19H22NO3+ and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 8876973 |
| Molecular Formula | C19H22NO3+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2ccc3c(c2)CCCC3)c(OC)c1 |
| InChI | InChI=1S/C19H22NO3/c1-22-16-7-8-17(19(11-16)23-2)18(21)13-20-10-9-14-5-3-4-6-15(14)12-20/h7-12H,3-6,13H2,1-2H3/q+1 |
| InChIKey | FWFVEPALGAYDLF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|