C18H23N2O+ — CID 8876887
2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 8876887) has the molecular formula C18H23N2O+ and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 8876887 |
| Molecular Formula | C18H23N2O+ |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccc3c(c2)CCCC3)c(C)n1C |
| InChI | InChI=1S/C18H23N2O/c1-13-10-17(14(2)19(13)3)18(21)12-20-9-8-15-6-4-5-7-16(15)11-20/h8-11H,4-7,12H2,1-3H3/q+1 |
| InChIKey | WUCCUKWPIQMCMF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|