C19H19N2O3+ — CID 8876671
6-[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 8876671) has the molecular formula C19H19N2O3+ and a molecular weight of 323.37 g/mol. Its IUPAC name is 6-[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 8876671 |
| Molecular Formula | C19H19N2O3+ |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 6-[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)C[n+]3ccc4c(c3)CCCC4)cc2N1 |
| InChI | InChI=1S/C19H18N2O3/c22-17(11-21-8-7-13-3-1-2-4-15(13)10-21)14-5-6-18-16(9-14)20-19(23)12-24-18/h5-10H,1-4,11-12H2/p+1 |
| InChIKey | QSSSPHYWQAABGN-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|