C22H18N3O5+ — CID 2396640
6-[2-[4-[(4-nitrophenyl)methyl]pyridin-1-ium-1-yl]acetyl]-4H-1,4-benzoxazin-3-one (PubChem CID 2396640) has the molecular formula C22H18N3O5+ and a molecular weight of 404.40 g/mol. Its IUPAC name is 6-[2-[4-[(4-nitrophenyl)methyl]pyridin-1-ium-1-yl]acetyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[4-[(4-nitrophenyl)methyl]pyridin-1-ium-1-yl]acetyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 2396640 |
| Molecular Formula | C22H18N3O5+ |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 6-[2-[4-[(4-nitrophenyl)methyl]pyridin-1-ium-1-yl]acetyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(=O)C[n+]3ccc(Cc4ccc([N+](=O)[O-])cc4)cc3)cc2N1 |
| InChI | InChI=1S/C22H17N3O5/c26-20(17-3-6-21-19(12-17)23-22(27)14-30-21)13-24-9-7-16(8-10-24)11-15-1-4-18(5-2-15)25(28)29/h1-10,12H,11,13-14H2/p+1 |
| InChIKey | FSJGYCLVIKRTEW-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|