C18H11N3O7 — CID 27264089
4-nitro-2-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]isoindole-1,3-dione (PubChem CID 27264089) has the molecular formula C18H11N3O7 and a molecular weight of 381.30 g/mol. Its IUPAC name is 4-nitro-2-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 27264089 |
| Molecular Formula | C18H11N3O7 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-nitro-2-[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1COc2ccc(C(=O)CN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2N1 |
| InChI | InChI=1S/C18H11N3O7/c22-13(9-4-5-14-11(6-9)19-15(23)8-28-14)7-20-17(24)10-2-1-3-12(21(26)27)16(10)18(20)25/h1-6H,7-8H2,(H,19,23) |
| InChIKey | SFCIXVYAXOTPNU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|