C23H17N3O7 — CID 4827018
2-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 4827018) has the molecular formula C23H17N3O7 and a molecular weight of 447.40 g/mol. Its IUPAC name is 2-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 4827018 |
| Molecular Formula | C23H17N3O7 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H17N3O7/c1-12-8-16(13(2)25(12)14-6-7-19-20(9-14)33-11-32-19)18(27)10-24-22(28)15-4-3-5-17(26(30)31)21(15)23(24)29/h3-9H,10-11H2,1-2H3 |
| InChIKey | UMZYMJDMMGSPJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|