C21H26N2O4 — CID 18093839
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2,6-dimethylmorpholin-4-yl)ethanone (PubChem CID 18093839) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2,6-dimethylmorpholin-4-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2,6-dimethylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 18093839 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(2,6-dimethylmorpholin-4-yl)ethanone |
| SMILES | Cc1cc(C(=O)CN2CC(C)OC(C)C2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H26N2O4/c1-13-7-18(19(24)11-22-9-14(2)27-15(3)10-22)16(4)23(13)17-5-6-20-21(8-17)26-12-25-20/h5-8,14-15H,9-12H2,1-4H3 |
| InChIKey | WDHLREZHJACIKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|