C22H24N4O3S — CID 42002200
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 42002200) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 42002200 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C(=O)CN2CCN(c3nccs3)CC2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H24N4O3S/c1-15-11-18(16(2)26(15)17-3-4-20-21(12-17)29-14-28-20)19(27)13-24-6-8-25(9-7-24)22-23-5-10-30-22/h3-5,10-12H,6-9,13-14H2,1-2H3 |
| InChIKey | WBXIKIUTXNFXNB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|