C22H26N2O6 — CID 166213267
ethyl 4-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]morpholine-2-carboxylate (PubChem CID 166213267) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is ethyl 4-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]morpholine-2-carboxylate.
| Compound Name | ethyl 4-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 166213267 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl 4-[2-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]morpholine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(CC(=O)c2cc(C)n(-c3ccc4c(c3)OCO4)c2C)CCO1 |
| InChI | InChI=1S/C22H26N2O6/c1-4-27-22(26)21-12-23(7-8-28-21)11-18(25)17-9-14(2)24(15(17)3)16-5-6-19-20(10-16)30-13-29-19/h5-6,9-10,21H,4,7-8,11-13H2,1-3H3 |
| InChIKey | HHRPGSMLAQIAAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|