C19H23N2O3+ — CID 9274871
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-pyrrolidin-1-ium-1-ylethanone (PubChem CID 9274871) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-pyrrolidin-1-ium-1-ylethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-pyrrolidin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 9274871 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-pyrrolidin-1-ium-1-ylethanone |
| SMILES | Cc1cc(C(=O)C[NH+]2CCCC2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O3/c1-13-9-16(17(22)11-20-7-3-4-8-20)14(2)21(13)15-5-6-18-19(10-15)24-12-23-18/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3/p+1 |
| InChIKey | FVSCWIBWRMYFHX-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|