C22H19N5O3 — CID 7225042
1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 7225042) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 7225042 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | Cc1cc(C(=O)Cn2nnc(-c3ccccc3)n2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19N5O3/c1-14-10-18(15(2)27(14)17-8-9-20-21(11-17)30-13-29-20)19(28)12-26-24-22(23-25-26)16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | DLTJAPNOVXCWNO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|