C21H17F2N5O — CID 7262853
1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone (PubChem CID 7262853) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 7262853 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[5-(4-fluorophenyl)tetrazol-2-yl]ethanone |
| SMILES | Cc1cc(C(=O)Cn2nnc(-c3ccc(F)cc3)n2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H17F2N5O/c1-13-10-19(14(2)28(13)18-5-3-4-17(23)11-18)20(29)12-27-25-21(24-26-27)15-6-8-16(22)9-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | JXOQMRAITHJWLR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|