C9H8FN5O — CID 30823221
2-[5-(3-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 30823221) has the molecular formula C9H8FN5O and a molecular weight of 221.20 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 30823221 |
| Molecular Formula | C9H8FN5O |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | NC(=O)Cn1nnc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C9H8FN5O/c10-7-3-1-2-6(4-7)9-12-14-15(13-9)5-8(11)16/h1-4H,5H2,(H2,11,16) |
| InChIKey | WQEDWHWTPOEZHP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |