C17H16FN5O2 — CID 8586996
2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 8586996) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 8586996 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(F)c2)n1)NCCOc1ccccc1 |
| InChI | InChI=1S/C17H16FN5O2/c18-14-6-4-5-13(11-14)17-20-22-23(21-17)12-16(24)19-9-10-25-15-7-2-1-3-8-15/h1-8,11H,9-10,12H2,(H,19,24) |
| InChIKey | IMHSQINEYDDNCN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|