C13H16FN5O — CID 30823164
2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-methylpropyl)acetamide (PubChem CID 30823164) has the molecular formula C13H16FN5O and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 30823164 |
| Molecular Formula | C13H16FN5O |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)Cn1nnc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H16FN5O/c1-9(2)7-15-12(20)8-19-17-13(16-18-19)10-4-3-5-11(14)6-10/h3-6,9H,7-8H2,1-2H3,(H,15,20) |
| InChIKey | XLQAAWVFHPREPK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |