C22H18F3N5O — CID 16508151
1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 16508151) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 16508151 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | Cc1cc(C(=O)Cn2nnc(-c3ccccc3)n2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F3N5O/c1-14-11-19(15(2)30(14)18-10-6-9-17(12-18)22(23,24)25)20(31)13-29-27-21(26-28-29)16-7-4-3-5-8-16/h3-12H,13H2,1-2H3 |
| InChIKey | UUUSOQHIBSFRBZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|