C20H19F3N4O — CID 7844990
1-(4-tert-butylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone (PubChem CID 7844990) has the molecular formula C20H19F3N4O and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone.
| Compound Name | 1-(4-tert-butylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 7844990 |
| Molecular Formula | C20H19F3N4O |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)Cn2nnc(-c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C20H19F3N4O/c1-19(2,3)15-9-7-13(8-10-15)17(28)12-27-25-18(24-26-27)14-5-4-6-16(11-14)20(21,22)23/h4-11H,12H2,1-3H3 |
| InChIKey | CHAQXJRKJSQPPY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |