C17H22F3N5O — CID 9491097
N-[(2R)-heptan-2-yl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 9491097) has the molecular formula C17H22F3N5O and a molecular weight of 369.39 g/mol. Its IUPAC name is N-[(2R)-heptan-2-yl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(2R)-heptan-2-yl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9491097 |
| Molecular Formula | C17H22F3N5O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(2R)-heptan-2-yl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)Cn1nnc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H22F3N5O/c1-3-4-5-7-12(2)21-15(26)11-25-23-16(22-24-25)13-8-6-9-14(10-13)17(18,19)20/h6,8-10,12H,3-5,7,11H2,1-2H3,(H,21,26)/t12-/m1/s1 |
| InChIKey | JRXQOSHAZCJPGW-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|