C22H23F3N3O+ — CID 8864933
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone (PubChem CID 8864933) has the molecular formula C22H23F3N3O+ and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 8864933 |
| Molecular Formula | C22H23F3N3O+ |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[n+]2ccc(N(C)C)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N3O/c1-15-12-20(21(29)14-27-10-8-18(9-11-27)26(3)4)16(2)28(15)19-7-5-6-17(13-19)22(23,24)25/h5-13H,14H2,1-4H3/q+1 |
| InChIKey | DFYJHDAUFLXSDO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|