C23H20F3NO4S — CID 41252640
[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-[(S)-methylsulfinyl]benzoate (PubChem CID 41252640) has the molecular formula C23H20F3NO4S and a molecular weight of 463.48 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-[(S)-methylsulfinyl]benzoate.
| Compound Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 41252640 |
| Molecular Formula | C23H20F3NO4S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethyl] 4-[(S)-methylsulfinyl]benzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc([S@](C)=O)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3NO4S/c1-14-11-20(15(2)27(14)18-6-4-5-17(12-18)23(24,25)26)21(28)13-31-22(29)16-7-9-19(10-8-16)32(3)30/h4-12H,13H2,1-3H3/t32-/m0/s1 |
| InChIKey | SEAATARQXXISND-YTTGMZPUSA-N |
| XLogP | 4.89 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|