C22H20F3NO4S — CID 55358864
1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylsulfonylphenoxy)ethanone (PubChem CID 55358864) has the molecular formula C22H20F3NO4S and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylsulfonylphenoxy)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 55358864 |
| Molecular Formula | C22H20F3NO4S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylsulfonylphenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2ccc(S(C)(=O)=O)cc2)c(C)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3NO4S/c1-14-11-20(15(2)26(14)17-6-4-5-16(12-17)22(23,24)25)21(27)13-30-18-7-9-19(10-8-18)31(3,28)29/h4-12H,13H2,1-3H3 |
| InChIKey | RFOILPCKKFSJAT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|