C23H19F3N2O3 — CID 18231484
4-[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethoxy]-3-methoxybenzonitrile (PubChem CID 18231484) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 4-[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 18231484 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-[2-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(=O)c1cc(C)n(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C23H19F3N2O3/c1-14-9-19(15(2)28(14)18-6-4-5-17(11-18)23(24,25)26)20(29)13-31-21-8-7-16(12-27)10-22(21)30-3/h4-11H,13H2,1-3H3 |
| InChIKey | AXGPUAOZRXTIMV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|