C21H20F3N2O+ — CID 8827407
1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 8827407) has the molecular formula C21H20F3N2O+ and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8827407 |
| Molecular Formula | C21H20F3N2O+ |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]-2-(4-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | Cc1cc[n+](CC(=O)c2cc(C)n(-c3cccc(C(F)(F)F)c3)c2C)cc1 |
| InChI | InChI=1S/C21H20F3N2O/c1-14-7-9-25(10-8-14)13-20(27)19-11-15(2)26(16(19)3)18-6-4-5-17(12-18)21(22,23)24/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | AOZSARNRLRQLFK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|