C14H14F3N — CID 58636933
2,3,5-trimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole (PubChem CID 58636933) has the molecular formula C14H14F3N and a molecular weight of 253.27 g/mol. Its IUPAC name is 2,3,5-trimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole.
| Compound Name | 2,3,5-trimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| PubChem CID | 58636933 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,3,5-trimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole |
| SMILES | Cc1cc(C)n(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C14H14F3N/c1-9-7-10(2)18(11(9)3)13-6-4-5-12(8-13)14(15,16)17/h4-8H,1-3H3 |
| InChIKey | NFBVVWMZPOKXOY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|