C20H23F3N2OS2 — CID 143009626
ethane;methyl N-[(E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enoyl]carbamodithioate (PubChem CID 143009626) has the molecular formula C20H23F3N2OS2 and a molecular weight of 428.55 g/mol. Its IUPAC name is ethane;methyl N-[(E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enoyl]carbamodithioate.
| Compound Name | ethane;methyl N-[(E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enoyl]carbamodithioate |
|---|---|
| PubChem CID | 143009626 |
| Molecular Formula | C20H23F3N2OS2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethane;methyl N-[(E)-3-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enoyl]carbamodithioate |
| SMILES | CC.CSC(=S)NC(=O)/C=C/c1cc(C)n(-c2cccc(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C18H17F3N2OS2.C2H6/c1-11-9-13(7-8-16(24)22-17(25)26-3)12(2)23(11)15-6-4-5-14(10-15)18(19,20)21;1-2/h4-10H,1-3H3,(H,22,24,25);1-2H3/b8-7+; |
| InChIKey | PIEFRWXAEMFDLS-USRGLUTNSA-N |
| XLogP | 5.92 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|