C25H28N2O — CID 18266697
(E)-N-(2,6-diethylphenyl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enamide (PubChem CID 18266697) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (E)-N-(2,6-diethylphenyl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,6-diethylphenyl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18266697 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (E)-N-(2,6-diethylphenyl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C=C/c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C25H28N2O/c1-5-20-11-10-12-21(6-2)25(20)26-24(28)16-15-22-17-18(3)27(19(22)4)23-13-8-7-9-14-23/h7-17H,5-6H2,1-4H3,(H,26,28)/b16-15+ |
| InChIKey | GHVDSDVTDOCPAM-FOCLMDBBSA-N |
| XLogP | 5.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|