C25H25N3O2 — CID 18230757
N-cyclopropyl-4-[[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]amino]benzamide (PubChem CID 18230757) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-cyclopropyl-4-[[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-[[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 18230757 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-cyclopropyl-4-[[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]amino]benzamide |
| SMILES | Cc1cc(/C=C/C(=O)Nc2ccc(C(=O)NC3CC3)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C25H25N3O2/c1-17-16-20(18(2)28(17)23-6-4-3-5-7-23)10-15-24(29)26-21-11-8-19(9-12-21)25(30)27-22-13-14-22/h3-12,15-16,22H,13-14H2,1-2H3,(H,26,29)(H,27,30)/b15-10+ |
| InChIKey | DNPUNCCZRCAXLA-XNTDXEJSSA-N |
| XLogP | 4.64 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|