C27H30N4O3S — CID 25332251
(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 25332251) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 25332251 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)Nc2ccc(S(=O)(=O)NC3=NCCCCC3)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H30N4O3S/c1-20-19-22(21(2)31(20)24-9-5-3-6-10-24)12-17-27(32)29-23-13-15-25(16-14-23)35(33,34)30-26-11-7-4-8-18-28-26/h3,5-6,9-10,12-17,19H,4,7-8,11,18H2,1-2H3,(H,28,30)(H,29,32)/b17-12+ |
| InChIKey | TWWJJTXIUSHKAE-SFQUDFHCSA-N |
| XLogP | 5.00 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|