C19H21N3O3S — CID 2324236
N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide (PubChem CID 2324236) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide.
| Compound Name | N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2324236 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2=NCCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3S/c23-19(15-7-3-1-4-8-15)21-16-10-12-17(13-11-16)26(24,25)22-18-9-5-2-6-14-20-18/h1,3-4,7-8,10-13H,2,5-6,9,14H2,(H,20,22)(H,21,23) |
| InChIKey | NYLHZBDBSAAQCN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |