C19H18ClF2N3O3S — CID 2107533
2-chloro-4,5-difluoro-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide (PubChem CID 2107533) has the molecular formula C19H18ClF2N3O3S and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2107533 |
| Molecular Formula | C19H18ClF2N3O3S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2=NCCCCC2)cc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H18ClF2N3O3S/c20-15-11-17(22)16(21)10-14(15)19(26)24-12-5-7-13(8-6-12)29(27,28)25-18-4-2-1-3-9-23-18/h5-8,10-11H,1-4,9H2,(H,23,25)(H,24,26) |
| InChIKey | AAPGUABPXVOKOB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|