C27H29N3O2 — CID 46521100
N-[1-[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]benzamide (PubChem CID 46521100) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[1-[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46521100 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[1-[(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)prop-2-enoyl]piperidin-4-yl]benzamide |
| SMILES | Cc1cc(/C=C/C(=O)N2CCC(NC(=O)c3ccccc3)CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H29N3O2/c1-20-19-23(21(2)30(20)25-11-7-4-8-12-25)13-14-26(31)29-17-15-24(16-18-29)28-27(32)22-9-5-3-6-10-22/h3-14,19,24H,15-18H2,1-2H3,(H,28,32)/b14-13+ |
| InChIKey | JVTFMJJZGXDLPB-BUHFOSPRSA-N |
| XLogP | 4.53 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|