C21H21ClN2O2 — CID 108559869
3-chloro-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]benzamide (PubChem CID 108559869) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-chloro-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108559869 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-chloro-N-[1-[(E)-3-phenylprop-2-enoyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)/C=C/c2ccccc2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClN2O2/c22-18-8-4-7-17(15-18)21(26)23-19-11-13-24(14-12-19)20(25)10-9-16-5-2-1-3-6-16/h1-10,15,19H,11-14H2,(H,23,26)/b10-9+ |
| InChIKey | GYKRGIFOSAAISG-MDZDMXLPSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|