C26H28N4O2 — CID 33309323
N-[1-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidin-4-yl]benzamide (PubChem CID 33309323) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[1-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 33309323 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[1-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]piperidin-4-yl]benzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N1CCC(NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N4O2/c1-19-24(20(2)30(28-19)23-11-7-4-8-12-23)13-14-25(31)29-17-15-22(16-18-29)27-26(32)21-9-5-3-6-10-21/h3-14,22H,15-18H2,1-2H3,(H,27,32)/b14-13+ |
| InChIKey | MADVRXQJHUCJBS-BUHFOSPRSA-N |
| XLogP | 3.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|