C22H26N6OS — CID 72688388
3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 72688388) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72688388 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[4-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=CC(=O)N1CCC(c2n[nH]c(=S)n2C)CC1 |
| InChI | InChI=1S/C22H26N6OS/c1-15-19(16(2)28(25-15)18-7-5-4-6-8-18)9-10-20(29)27-13-11-17(12-14-27)21-23-24-22(30)26(21)3/h4-10,17H,11-14H2,1-3H3,(H,24,30) |
| InChIKey | NEOOCNJTJOTROA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|