C22H27N3O3 — CID 56547493
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 56547493) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56547493 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-[3-(1,3-dioxolan-2-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)N1CCCC(C2OCCO2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-16-20(17(2)25(23-16)19-8-4-3-5-9-19)10-11-21(26)24-12-6-7-18(15-24)22-27-13-14-28-22/h3-5,8-11,18,22H,6-7,12-15H2,1-2H3/b11-10+ |
| InChIKey | WDCNBQDYXHULHO-ZHACJKMWSA-N |
| XLogP | 3.11 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|