C21H27N3O — CID 134028246
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 134028246) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134028246 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)/C=C/c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H27N3O/c1-4-18-10-8-9-15-23(18)21(25)14-13-20-16(2)22-24(17(20)3)19-11-6-5-7-12-19/h5-7,11-14,18H,4,8-10,15H2,1-3H3/b14-13+ |
| InChIKey | RPOMPHDJZHNKOF-BUHFOSPRSA-N |
| XLogP | 4.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|