C21H27N3O — CID 71939418
1-[2-(2-phenylethyl)pyrrolidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 71939418) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[2-(2-phenylethyl)pyrrolidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-[2-(2-phenylethyl)pyrrolidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71939418 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-[2-(2-phenylethyl)pyrrolidin-1-yl]-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nn(C)c(C)c1C=CC(=O)N1CCCC1CCc1ccccc1 |
| InChI | InChI=1S/C21H27N3O/c1-16-20(17(2)23(3)22-16)13-14-21(25)24-15-7-10-19(24)12-11-18-8-5-4-6-9-18/h4-6,8-9,13-14,19H,7,10-12,15H2,1-3H3 |
| InChIKey | ZLIJIZQLBJQYKD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|