C20H24ClN3O — CID 94616061
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[(2R)-2-(2-phenylethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 94616061) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[(2R)-2-(2-phenylethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[(2R)-2-(2-phenylethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 94616061 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[(2R)-2-(2-phenylethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)N1CCC[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C20H24ClN3O/c1-15-18(20(21)23(2)22-15)12-13-19(25)24-14-6-9-17(24)11-10-16-7-4-3-5-8-16/h3-5,7-8,12-13,17H,6,9-11,14H2,1-2H3/b13-12+/t17-/m0/s1 |
| InChIKey | MEWNLPVDEORCSB-UJGDBWEASA-N |
| XLogP | 4.02 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|