C18H22ClN3O — CID 97119632
(4-chloro-1-methylpyrazol-3-yl)-[(2R)-2-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 97119632) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-3-yl)-[(2R)-2-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | (4-chloro-1-methylpyrazol-3-yl)-[(2R)-2-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97119632 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (4-chloro-1-methylpyrazol-3-yl)-[(2R)-2-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | Cn1cc(Cl)c(C(=O)N2CCCC[C@@H]2CCc2ccccc2)n1 |
| InChI | InChI=1S/C18H22ClN3O/c1-21-13-16(19)17(20-21)18(23)22-12-6-5-9-15(22)11-10-14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3/t15-/m1/s1 |
| InChIKey | CMWDVCCQJNBUIR-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |