C16H17ClN4O3 — CID 6243234
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[2-(furan-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one (PubChem CID 6243234) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[2-(furan-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[2-(furan-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6243234 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-[2-(furan-2-carbonyl)pyrazolidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)N1CCCN1C(=O)c1ccco1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-11-12(15(17)19(2)18-11)6-7-14(22)20-8-4-9-21(20)16(23)13-5-3-10-24-13/h3,5-7,10H,4,8-9H2,1-2H3/b7-6+ |
| InChIKey | JUGTUJRTRMBRKP-VOTSOKGWSA-N |
| XLogP | 2.28 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|