C14H21ClN4O — CID 126790036
1-[2-(aminomethyl)piperidin-1-yl]-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 126790036) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-[2-(aminomethyl)piperidin-1-yl]-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-[2-(aminomethyl)piperidin-1-yl]-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126790036 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[2-(aminomethyl)piperidin-1-yl]-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)N1CCCCC1CN |
| InChI | InChI=1S/C14H21ClN4O/c1-10-12(14(15)18(2)17-10)6-7-13(20)19-8-4-3-5-11(19)9-16/h6-7,11H,3-5,8-9,16H2,1-2H3 |
| InChIKey | ZLHDBLDEDVKLOI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|