C18H28ClN3O — CID 75981659
3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 75981659) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75981659 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)C=Cc1c(C)nn(CC(C)C)c1Cl |
| InChI | InChI=1S/C18H28ClN3O/c1-5-15-8-6-7-11-21(15)17(23)10-9-16-14(4)20-22(18(16)19)12-13(2)3/h9-10,13,15H,5-8,11-12H2,1-4H3 |
| InChIKey | BBLCGPHHXHNBKM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|