C22H29ClN4O — CID 55979775
(E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 55979775) has the molecular formula C22H29ClN4O and a molecular weight of 400.95 g/mol. Its IUPAC name is (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55979775 |
| Molecular Formula | C22H29ClN4O |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=C/C(=O)NCc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C22H29ClN4O/c1-16(2)15-27-22(23)19(17(3)25-27)10-11-21(28)24-14-18-8-4-5-9-20(18)26-12-6-7-13-26/h4-5,8-11,16H,6-7,12-15H2,1-3H3,(H,24,28)/b11-10+ |
| InChIKey | APBLOQFIRJBNFC-ZHACJKMWSA-N |
| XLogP | 4.43 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|