C17H28ClN3O2 — CID 111486473
3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-hydroxy-2,3-dimethylbutyl)prop-2-enamide (PubChem CID 111486473) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-hydroxy-2,3-dimethylbutyl)prop-2-enamide.
| Compound Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-hydroxy-2,3-dimethylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 111486473 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]-N-(2-hydroxy-2,3-dimethylbutyl)prop-2-enamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1C=CC(=O)NCC(C)(O)C(C)C |
| InChI | InChI=1S/C17H28ClN3O2/c1-11(2)9-21-16(18)14(13(5)20-21)7-8-15(22)19-10-17(6,23)12(3)4/h7-8,11-12,23H,9-10H2,1-6H3,(H,19,22) |
| InChIKey | WYKUGWDWIAIGED-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|