C17H18Cl2FN3O — CID 26244997
(E)-N-(2-chloro-4-fluorophenyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 26244997) has the molecular formula C17H18Cl2FN3O and a molecular weight of 370.26 g/mol. Its IUPAC name is (E)-N-(2-chloro-4-fluorophenyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-4-fluorophenyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 26244997 |
| Molecular Formula | C17H18Cl2FN3O |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (E)-N-(2-chloro-4-fluorophenyl)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=C/C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H18Cl2FN3O/c1-10(2)9-23-17(19)13(11(3)22-23)5-7-16(24)21-15-6-4-12(20)8-14(15)18/h4-8,10H,9H2,1-3H3,(H,21,24)/b7-5+ |
| InChIKey | CRFPJJPCQFXBGT-FNORWQNLSA-N |
| XLogP | 4.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|