C17H17ClFN3O4 — CID 52893791
(5-fluoro-2-nitrophenyl) (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 52893791) has the molecular formula C17H17ClFN3O4 and a molecular weight of 381.79 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | (5-fluoro-2-nitrophenyl) (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 52893791 |
| Molecular Formula | C17H17ClFN3O4 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=C/C(=O)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClFN3O4/c1-10(2)9-21-17(18)13(11(3)20-21)5-7-16(23)26-15-8-12(19)4-6-14(15)22(24)25/h4-8,10H,9H2,1-3H3/b7-5+ |
| InChIKey | AVZSBDPTFVQVQI-FNORWQNLSA-N |
| XLogP | 4.17 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|