C19H21ClN4O5 — CID 7904813
[2-(3-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 7904813) has the molecular formula C19H21ClN4O5 and a molecular weight of 420.85 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7904813 |
| Molecular Formula | C19H21ClN4O5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] (E)-3-[5-chloro-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(CC(C)C)c(Cl)c1/C=C/C(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN4O5/c1-12(2)10-23-19(20)16(13(3)22-23)7-8-18(26)29-11-17(25)21-14-5-4-6-15(9-14)24(27)28/h4-9,12H,10-11H2,1-3H3,(H,21,25)/b8-7+ |
| InChIKey | ZSZJBIKSKSHWNA-BQYQJAHWSA-N |
| XLogP | 3.60 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|