C22H19ClN4O5 — CID 29316284
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 29316284) has the molecular formula C22H19ClN4O5 and a molecular weight of 454.87 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 29316284 |
| Molecular Formula | C22H19ClN4O5 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H19ClN4O5/c1-14-18(15(2)26(25-14)16-6-4-3-5-7-16)9-11-22(29)32-13-21(28)24-20-12-17(27(30)31)8-10-19(20)23/h3-12H,13H2,1-2H3,(H,24,28)/b11-9+ |
| InChIKey | RFSFSMDCINVZGX-PKNBQFBNSA-N |
| XLogP | 4.25 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|