C24H23N3O4 — CID 7913301
[2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 7913301) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7913301 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)/C=C/c2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-16-22(17(2)27(26-16)21-10-5-4-6-11-21)12-13-24(30)31-15-23(29)25-20-9-7-8-19(14-20)18(3)28/h4-14H,15H2,1-3H3,(H,25,29)/b13-12+ |
| InChIKey | HZCGQBJPLBMGNO-OUKQBFOZSA-N |
| XLogP | 3.89 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|