C18H18F3N3O3 — CID 2403871
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 2403871) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2403871 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O3/c1-12-15(13(2)24(23-12)14-6-4-3-5-7-14)8-9-17(26)27-10-16(25)22-11-18(19,20)21/h3-9H,10-11H2,1-2H3,(H,22,25)/b9-8+ |
| InChIKey | GVLUEKLXEXSMNN-CMDGGOBGSA-N |
| XLogP | 2.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|